C24H24ClN3O3 — CID 46559911
N-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide (PubChem CID 46559911) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46559911 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)N1CCN(c2cccc(Cl)c2)CC1)c1ccco1 |
| InChI | InChI=1S/C24H24ClN3O3/c25-19-8-4-9-20(17-19)27-11-13-28(14-12-27)24(30)21(16-18-6-2-1-3-7-18)26-23(29)22-10-5-15-31-22/h1-10,15,17,21H,11-14,16H2,(H,26,29) |
| InChIKey | MMGVICJUMROELQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |