C23H24BrN3O — CID 86885933
2-[[1-(3-bromophenyl)cyclobutyl]amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 86885933) has the molecular formula C23H24BrN3O and a molecular weight of 438.37 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclobutyl]amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-[[1-(3-bromophenyl)cyclobutyl]amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 86885933 |
| Molecular Formula | C23H24BrN3O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclobutyl]amino]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | O=C(CNC1(c2cccc(Br)c2)CCC1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C23H24BrN3O/c24-17-6-3-5-16(13-17)23(10-4-11-23)25-14-22(28)27-12-9-21-19(15-27)18-7-1-2-8-20(18)26-21/h1-3,5-8,13,25-26H,4,9-12,14-15H2 |
| InChIKey | WZAUSMSEYZSIEL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|