C16H16Br2N2O — CID 112536771
(2,3-dibromo-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl)-(3,4-dimethylphenyl)methanone (PubChem CID 112536771) has the molecular formula C16H16Br2N2O and a molecular weight of 412.13 g/mol. Its IUPAC name is (2,3-dibromo-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl)-(3,4-dimethylphenyl)methanone.
| Compound Name | (2,3-dibromo-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl)-(3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 112536771 |
| Molecular Formula | C16H16Br2N2O |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | (2,3-dibromo-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl)-(3,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCc3[nH]c(Br)c(Br)c3C2)cc1C |
| InChI | InChI=1S/C16H16Br2N2O/c1-9-3-4-11(7-10(9)2)16(21)20-6-5-13-12(8-20)14(17)15(18)19-13/h3-4,7,19H,5-6,8H2,1-2H3 |
| InChIKey | PTZMMOKLFJEAMO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |