C15H18N2O4 — CID 115966211
7-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 115966211) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 7-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115966211 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 7-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(O)C1CCN(C(=O)c2ccc3c(c2)OCC(=O)N3)C1 |
| InChI | InChI=1S/C15H18N2O4/c1-9(18)11-4-5-17(7-11)15(20)10-2-3-12-13(6-10)21-8-14(19)16-12/h2-3,6,9,11,18H,4-5,7-8H2,1H3,(H,16,19) |
| InChIKey | CUIBOWJZUNGKAF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |