C18H21ClN2O2 — CID 70786279
(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1-(methoxymethyl)cyclobutyl]methanone (PubChem CID 70786279) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1-(methoxymethyl)cyclobutyl]methanone.
| Compound Name | (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1-(methoxymethyl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 70786279 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1-(methoxymethyl)cyclobutyl]methanone |
| SMILES | COCC1(C(=O)N2CCc3[nH]c4ccc(Cl)cc4c3C2)CCC1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-23-11-18(6-2-7-18)17(22)21-8-5-16-14(10-21)13-9-12(19)3-4-15(13)20-16/h3-4,9,20H,2,5-8,10-11H2,1H3 |
| InChIKey | MCDNDRWDVDFEGN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|