C19H22ClN3O3 — CID 94664366
(4R)-4-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(2-methoxyethyl)pyrrolidin-2-one (PubChem CID 94664366) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is (4R)-4-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(2-methoxyethyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(2-methoxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 94664366 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (4R)-4-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(2-methoxyethyl)pyrrolidin-2-one |
| SMILES | COCCN1C[C@H](C(=O)N2CCc3[nH]c4ccc(Cl)cc4c3C2)CC1=O |
| InChI | InChI=1S/C19H22ClN3O3/c1-26-7-6-22-10-12(8-18(22)24)19(25)23-5-4-17-15(11-23)14-9-13(20)2-3-16(14)21-17/h2-3,9,12,21H,4-8,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | CAWHCPRXMRXSSU-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|