C19H19ClN4OS — CID 166299369
(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 166299369) has the molecular formula C19H19ClN4OS and a molecular weight of 386.91 g/mol. Its IUPAC name is (2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 166299369 |
| Molecular Formula | C19H19ClN4OS |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Nc1nc2c(s1)CCCC2C(=O)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C19H19ClN4OS/c20-10-4-5-14-12(8-10)13-9-24(7-6-15(13)22-14)18(25)11-2-1-3-16-17(11)23-19(21)26-16/h4-5,8,11,22H,1-3,6-7,9H2,(H2,21,23) |
| InChIKey | MZSNQRGBGWMTSO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|