C22H30ClN3O4S — CID 55469270
[1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 55469270) has the molecular formula C22H30ClN3O4S and a molecular weight of 468.02 g/mol. Its IUPAC name is [1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 55469270 |
| Molecular Formula | C22H30ClN3O4S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1)N1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H30ClN3O4S/c23-19-7-6-18(16-20(19)31(29,30)26-12-2-1-3-13-26)22(28)25-14-8-17(9-15-25)21(27)24-10-4-5-11-24/h6-7,16-17H,1-5,8-15H2 |
| InChIKey | MHKOOGMLCNDCDA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |