C24H29ClN2O3S — CID 134016677
[3-(4-benzylpiperidin-1-yl)sulfonyl-4-chlorophenyl]-piperidin-1-ylmethanone (PubChem CID 134016677) has the molecular formula C24H29ClN2O3S and a molecular weight of 461.03 g/mol. Its IUPAC name is [3-(4-benzylpiperidin-1-yl)sulfonyl-4-chlorophenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-(4-benzylpiperidin-1-yl)sulfonyl-4-chlorophenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 134016677 |
| Molecular Formula | C24H29ClN2O3S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [3-(4-benzylpiperidin-1-yl)sulfonyl-4-chlorophenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Cl)c(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H29ClN2O3S/c25-22-10-9-21(24(28)26-13-5-2-6-14-26)18-23(22)31(29,30)27-15-11-20(12-16-27)17-19-7-3-1-4-8-19/h1,3-4,7-10,18,20H,2,5-6,11-17H2 |
| InChIKey | KZLVJYVCOLYTCV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |