C21H26ClN5O3S — CID 2479205
[3-(azepan-1-ylsulfonyl)-4-chlorophenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 2479205) has the molecular formula C21H26ClN5O3S and a molecular weight of 463.99 g/mol. Its IUPAC name is [3-(azepan-1-ylsulfonyl)-4-chlorophenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [3-(azepan-1-ylsulfonyl)-4-chlorophenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 2479205 |
| Molecular Formula | C21H26ClN5O3S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [3-(azepan-1-ylsulfonyl)-4-chlorophenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H26ClN5O3S/c22-18-7-6-17(16-19(18)31(29,30)27-10-3-1-2-4-11-27)20(28)25-12-14-26(15-13-25)21-23-8-5-9-24-21/h5-9,16H,1-4,10-15H2 |
| InChIKey | NOGCUTMKNJWEBG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |