C18H23N5O3S2 — CID 50777455
piperidin-1-yl-[5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylthiophen-3-yl]methanone (PubChem CID 50777455) has the molecular formula C18H23N5O3S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is piperidin-1-yl-[5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylthiophen-3-yl]methanone.
| Compound Name | piperidin-1-yl-[5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylthiophen-3-yl]methanone |
|---|---|
| PubChem CID | 50777455 |
| Molecular Formula | C18H23N5O3S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | piperidin-1-yl-[5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylthiophen-3-yl]methanone |
| SMILES | O=C(c1csc(S(=O)(=O)N2CCN(c3ncccn3)CC2)c1)N1CCCCC1 |
| InChI | InChI=1S/C18H23N5O3S2/c24-17(21-7-2-1-3-8-21)15-13-16(27-14-15)28(25,26)23-11-9-22(10-12-23)18-19-5-4-6-20-18/h4-6,13-14H,1-3,7-12H2 |
| InChIKey | GJWWSZBNOKTSAV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |