C15H15N3O5S2 — CID 119146278
5-[4-(pyridine-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylic acid (PubChem CID 119146278) has the molecular formula C15H15N3O5S2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 5-[4-(pyridine-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylic acid.
| Compound Name | 5-[4-(pyridine-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 119146278 |
| Molecular Formula | C15H15N3O5S2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 5-[4-(pyridine-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(S(=O)(=O)N2CCN(C(=O)c3ccncc3)CC2)c1 |
| InChI | InChI=1S/C15H15N3O5S2/c19-14(11-1-3-16-4-2-11)17-5-7-18(8-6-17)25(22,23)13-9-12(10-24-13)15(20)21/h1-4,9-10H,5-8H2,(H,20,21) |
| InChIKey | VZLLUZBEYCHHMA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |