C20H20ClN3O4 — CID 18980300
4-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]oxybutan-1-ol (PubChem CID 18980300) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]oxybutan-1-ol.
| Compound Name | 4-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]oxybutan-1-ol |
|---|---|
| PubChem CID | 18980300 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]oxybutan-1-ol |
| SMILES | OCCCCOc1nc(NCc2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C20H20ClN3O4/c21-14-4-5-16-15(10-14)19(24-20(23-16)26-8-2-1-7-25)22-11-13-3-6-17-18(9-13)28-12-27-17/h3-6,9-10,25H,1-2,7-8,11-12H2,(H,22,23,24) |
| InChIKey | VBTXQUSSIGOTHY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|