C16H11ClN4O4 — CID 19709765
N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-6-nitroquinazolin-4-amine (PubChem CID 19709765) has the molecular formula C16H11ClN4O4 and a molecular weight of 358.74 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-6-nitroquinazolin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 19709765 |
| Molecular Formula | C16H11ClN4O4 |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-6-nitroquinazolin-4-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(Cl)nc(NCc3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C16H11ClN4O4/c17-16-19-12-3-2-10(21(22)23)6-11(12)15(20-16)18-7-9-1-4-13-14(5-9)25-8-24-13/h1-6H,7-8H2,(H,18,19,20) |
| InChIKey | AVHIKOIBZSAEGO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|