C19H14ClN3O4 — CID 18796748
(E)-3-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]prop-2-enoic acid (PubChem CID 18796748) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is (E)-3-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18796748 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (E)-3-[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nc(NCc2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C19H14ClN3O4/c20-12-2-3-14-13(8-12)19(23-17(22-14)5-6-18(24)25)21-9-11-1-4-15-16(7-11)27-10-26-15/h1-8H,9-10H2,(H,24,25)(H,21,22,23)/b6-5+ |
| InChIKey | OQDAUBRXCXFCGB-AATRIKPKSA-N |
| XLogP | 3.72 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|