C24H15ClN2O3S — CID 90647130
6-(1,3-benzodioxol-5-ylmethylamino)-10-chlorothiochromeno[2,3-c]quinolin-12-one (PubChem CID 90647130) has the molecular formula C24H15ClN2O3S and a molecular weight of 446.92 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-10-chlorothiochromeno[2,3-c]quinolin-12-one.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-10-chlorothiochromeno[2,3-c]quinolin-12-one |
|---|---|
| PubChem CID | 90647130 |
| Molecular Formula | C24H15ClN2O3S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-10-chlorothiochromeno[2,3-c]quinolin-12-one |
| SMILES | O=c1c2cc(Cl)ccc2sc2c(NCc3ccc4c(c3)OCO4)nc3ccccc3c12 |
| InChI | InChI=1S/C24H15ClN2O3S/c25-14-6-8-20-16(10-14)22(28)21-15-3-1-2-4-17(15)27-24(23(21)31-20)26-11-13-5-7-18-19(9-13)30-12-29-18/h1-10H,11-12H2,(H,26,27) |
| InChIKey | GJTGLNSYGMJLHL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|