C19H18ClN3NaO7S — CID 158745583
CID 158745583 (PubChem CID 158745583) has the molecular formula C19H18ClN3NaO7S and a molecular weight of 490.88 g/mol.
| Compound Name | CID 158745583 |
|---|---|
| PubChem CID | 158745583 |
| Molecular Formula | C19H18ClN3NaO7S |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)OCCCOc1nc(NCc2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1.[Na] |
| InChI | InChI=1S/C19H18ClN3O7S.Na/c20-13-3-4-15-14(9-13)18(21-10-12-2-5-16-17(8-12)29-11-28-16)23-19(22-15)27-6-1-7-30-31(24,25)26;/h2-5,8-9H,1,6-7,10-11H2,(H,21,22,23)(H,24,25,26); |
| InChIKey | IMVQITOMNSCLRO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|