C18H14Br2N4O2 — CID 139962103
N-(2,5-dibromophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 139962103) has the molecular formula C18H14Br2N4O2 and a molecular weight of 478.14 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-(2,5-dibromophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 139962103 |
| Molecular Formula | C18H14Br2N4O2 |
| Molecular Weight | 478.14 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | N-(2,5-dibromophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | COc1cc2[nH]c3c(Nc4cc(Br)ccc4Br)ncnc3c2cc1OC |
| InChI | InChI=1S/C18H14Br2N4O2/c1-25-14-6-10-12(7-15(14)26-2)23-17-16(10)21-8-22-18(17)24-13-5-9(19)3-4-11(13)20/h3-8,23H,1-2H3,(H,21,22,24) |
| InChIKey | ITQCMEYZEDAKBR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.14 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |