C18H14F2N4O2 — CID 139962098
N-(2,6-difluorophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 139962098) has the molecular formula C18H14F2N4O2 and a molecular weight of 356.33 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-(2,6-difluorophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 139962098 |
| Molecular Formula | C18H14F2N4O2 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-7,8-dimethoxy-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | COc1cc2[nH]c3c(Nc4c(F)cccc4F)ncnc3c2cc1OC |
| InChI | InChI=1S/C18H14F2N4O2/c1-25-13-6-9-12(7-14(13)26-2)23-17-15(9)21-8-22-18(17)24-16-10(19)4-3-5-11(16)20/h3-8,23H,1-2H3,(H,21,22,24) |
| InChIKey | PRVLTTAWYCZDKE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |