C20H19N5O2 — CID 4973329
N-[(2,3-dimethoxyphenyl)methylideneamino]-7-methyl-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 4973329) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methylideneamino]-7-methyl-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-[(2,3-dimethoxyphenyl)methylideneamino]-7-methyl-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 4973329 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methylideneamino]-7-methyl-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | COc1cccc(C=NNc2ncnc3c2[nH]c2cc(C)ccc23)c1OC |
| InChI | InChI=1S/C20H19N5O2/c1-12-7-8-14-15(9-12)24-18-17(14)21-11-22-20(18)25-23-10-13-5-4-6-16(26-2)19(13)27-3/h4-11,24H,1-3H3,(H,21,22,25) |
| InChIKey | UDNWWAMEIUHPPG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|