C19H17N5O2 — CID 6220123
N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 6220123) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 6220123 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | COc1cccc(/C=N\Nc2ncnc3c2[nH]c2ccccc23)c1OC |
| InChI | InChI=1S/C19H17N5O2/c1-25-15-9-5-6-12(18(15)26-2)10-22-24-19-17-16(20-11-21-19)13-7-3-4-8-14(13)23-17/h3-11,23H,1-2H3,(H,20,21,24)/b22-10- |
| InChIKey | MIHFBVVYKDWFRK-YVNNLAQVSA-N |
| XLogP | 3.57 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|