C21H26N4O3 — CID 143204728
N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine;2-ethoxyprop-1-ene (PubChem CID 143204728) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine;2-ethoxyprop-1-ene.
| Compound Name | N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine;2-ethoxyprop-1-ene |
|---|---|
| PubChem CID | 143204728 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine;2-ethoxyprop-1-ene |
| SMILES | C=C(C)OCC.COc1cccc(/C=N/Nc2nc3ccccc3[nH]2)c1OC |
| InChI | InChI=1S/C16H16N4O2.C5H10O/c1-21-14-9-5-6-11(15(14)22-2)10-17-20-16-18-12-7-3-4-8-13(12)19-16;1-4-6-5(2)3/h3-10H,1-2H3,(H2,18,19,20);2,4H2,1,3H3/b17-10+; |
| InChIKey | NXFWIGQIWMPUNJ-LZMXEPDESA-N |
| XLogP | 4.58 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|