C20H18N4O2 — CID 3712194
N-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 3712194) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 3712194 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(4,8-dimethoxynaphthalen-1-yl)methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | COc1ccc(C=NNc2nc3ccccc3[nH]2)c2c(OC)cccc12 |
| InChI | InChI=1S/C20H18N4O2/c1-25-17-11-10-13(19-14(17)6-5-9-18(19)26-2)12-21-24-20-22-15-7-3-4-8-16(15)23-20/h3-12H,1-2H3,(H2,22,23,24) |
| InChIKey | JJWSDOVNHOPDRC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|