C20H19F3N4O3S — CID 163431618
1-[5-[amino(dihydroxy)-λ4-sulfanyl]-2-anilinophenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 163431618) has the molecular formula C20H19F3N4O3S and a molecular weight of 452.46 g/mol. Its IUPAC name is 1-[5-[amino(dihydroxy)-λ4-sulfanyl]-2-anilinophenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[amino(dihydroxy)-λ4-sulfanyl]-2-anilinophenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 163431618 |
| Molecular Formula | C20H19F3N4O3S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[5-[amino(dihydroxy)-λ4-sulfanyl]-2-anilinophenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | NS(O)(O)c1ccc(Nc2ccccc2)c(NC(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H19F3N4O3S/c21-20(22,23)13-5-4-8-15(11-13)26-19(28)27-18-12-16(31(24,29)30)9-10-17(18)25-14-6-2-1-3-7-14/h1-12,25,29-30H,24H2,(H2,26,27,28) |
| InChIKey | AQZBPUCHKUFBST-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |