C18H16F3N3O3S2 — CID 162082379
1-[5-sulfamoyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 162082379) has the molecular formula C18H16F3N3O3S2 and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-[5-sulfamoyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-sulfamoyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162082379 |
| Molecular Formula | C18H16F3N3O3S2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 1-[5-sulfamoyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | C=C/C(=C\S)c1ccc(S(N)(=O)=O)cc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N3O3S2/c1-2-11(10-28)15-7-6-14(29(22,26)27)9-16(15)24-17(25)23-13-5-3-4-12(8-13)18(19,20)21/h2-10,28H,1H2,(H2,22,26,27)(H2,23,24,25)/b11-10+ |
| InChIKey | ZCMVCPWDQHIYPL-ZHACJKMWSA-N |
| XLogP | 4.45 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|