C12H14N6O2 — CID 107000026
N-[2-(2-aminoethylcarbamoyl)phenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 107000026) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-[2-(2-aminoethylcarbamoyl)phenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[2-(2-aminoethylcarbamoyl)phenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 107000026 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[2-(2-aminoethylcarbamoyl)phenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NCCNC(=O)c1ccccc1NC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C12H14N6O2/c13-5-6-14-11(19)8-3-1-2-4-9(8)17-12(20)10-15-7-16-18-10/h1-4,7H,5-6,13H2,(H,14,19)(H,17,20)(H,15,16,18) |
| InChIKey | GMCLNRDAEJCNOP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |