C11H13ClN4O — CID 117071392
N-(2-ethylphenyl)-1H-1,2,4-triazole-5-carboxamide;hydrochloride (PubChem CID 117071392) has the molecular formula C11H13ClN4O and a molecular weight of 252.71 g/mol. Its IUPAC name is N-(2-ethylphenyl)-1H-1,2,4-triazole-5-carboxamide;hydrochloride.
| Compound Name | N-(2-ethylphenyl)-1H-1,2,4-triazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 117071392 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | N-(2-ethylphenyl)-1H-1,2,4-triazole-5-carboxamide;hydrochloride |
| SMILES | CCc1ccccc1NC(=O)c1ncn[nH]1.Cl |
| InChI | InChI=1S/C11H12N4O.ClH/c1-2-8-5-3-4-6-9(8)14-11(16)10-12-7-13-15-10;/h3-7H,2H2,1H3,(H,14,16)(H,12,13,15);1H |
| InChIKey | NUQWTCBETHTJNJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |