C14H16FN3O — CID 63597655
4-fluoro-5-methoxy-1-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine (PubChem CID 63597655) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methoxy-1-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63597655 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-fluoro-5-methoxy-1-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine |
| SMILES | COc1cc(NCCc2ccncc2)c(N)cc1F |
| InChI | InChI=1S/C14H16FN3O/c1-19-14-9-13(12(16)8-11(14)15)18-7-4-10-2-5-17-6-3-10/h2-3,5-6,8-9,18H,4,7,16H2,1H3 |
| InChIKey | PJIIWKITRATNGC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|