C12H17N5O — CID 83001895
2-propan-2-yloxy-4-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine (PubChem CID 83001895) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-propan-2-yloxy-4-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-propan-2-yloxy-4-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 83001895 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-propan-2-yloxy-4-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine |
| SMILES | CC(C)Oc1cc(NCc2ncn[nH]2)ccc1N |
| InChI | InChI=1S/C12H17N5O/c1-8(2)18-11-5-9(3-4-10(11)13)14-6-12-15-7-16-17-12/h3-5,7-8,14H,6,13H2,1-2H3,(H,15,16,17) |
| InChIKey | JVNPHCNMLPDRNS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|