C8H6FN5O2 — CID 12962771
5-fluoro-2-hydroxy-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 12962771) has the molecular formula C8H6FN5O2 and a molecular weight of 223.17 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 5-fluoro-2-hydroxy-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 12962771 |
| Molecular Formula | C8H6FN5O2 |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 5-fluoro-2-hydroxy-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | O=C(Nc1nn[nH]n1)c1cc(F)ccc1O |
| InChI | InChI=1S/C8H6FN5O2/c9-4-1-2-6(15)5(3-4)7(16)10-8-11-13-14-12-8/h1-3,15H,(H2,10,11,12,13,14,16) |
| InChIKey | ONTAHVUYIUWHHP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |