C16H18N2O — CID 115379070
1-[3-(dimethylamino)phenyl]-6,7-dihydro-5H-indol-4-one (PubChem CID 115379070) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[3-(dimethylamino)phenyl]-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-[3-(dimethylamino)phenyl]-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 115379070 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-[3-(dimethylamino)phenyl]-6,7-dihydro-5H-indol-4-one |
| SMILES | CN(C)c1cccc(-n2ccc3c2CCCC3=O)c1 |
| InChI | InChI=1S/C16H18N2O/c1-17(2)12-5-3-6-13(11-12)18-10-9-14-15(18)7-4-8-16(14)19/h3,5-6,9-11H,4,7-8H2,1-2H3 |
| InChIKey | UVABCSVGBYELJC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |