C12H17N3 — CID 115378503
3-(2-iminopyrrolidin-1-yl)-N,N-dimethylaniline (PubChem CID 115378503) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylaniline.
| Compound Name | 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 115378503 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylaniline |
| SMILES | [H]/N=C1\CCCN1c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C12H17N3/c1-14(2)10-5-3-6-11(9-10)15-8-4-7-12(15)13/h3,5-6,9,13H,4,7-8H2,1-2H3/b13-12+ |
| InChIKey | UYSNIAPTIOGFGE-OUKQBFOZSA-N |
| XLogP | 2.33 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|