C12H10F3N3 — CID 65484359
4-(2-iminopyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 65484359) has the molecular formula C12H10F3N3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 4-(2-iminopyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(2-iminopyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 65484359 |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 4-(2-iminopyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | [H]/N=C1\CCCN1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3N3/c13-12(14,15)10-6-9(4-3-8(10)7-16)18-5-1-2-11(18)17/h3-4,6,17H,1-2,5H2/b17-11+ |
| InChIKey | KRRYZQHRCPVVFI-GZTJUZNOSA-N |
| XLogP | 3.15 |
| TPSA | 50.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|