C15H15F3N4S — CID 141160952
4-(4-imino-2-sulfanyl-1,3-diazaspiro[4.4]nonan-3-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 141160952) has the molecular formula C15H15F3N4S and a molecular weight of 340.37 g/mol. Its IUPAC name is 4-(4-imino-2-sulfanyl-1,3-diazaspiro[4.4]nonan-3-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4-imino-2-sulfanyl-1,3-diazaspiro[4.4]nonan-3-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 141160952 |
| Molecular Formula | C15H15F3N4S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(4-imino-2-sulfanyl-1,3-diazaspiro[4.4]nonan-3-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | [H]/N=C1\N(c2ccc(C#N)c(C(F)(F)F)c2)C(S)NC12CCCC2 |
| InChI | InChI=1S/C15H15F3N4S/c16-15(17,18)11-7-10(4-3-9(11)8-19)22-12(20)14(21-13(22)23)5-1-2-6-14/h3-4,7,13,20-21,23H,1-2,5-6H2/b20-12- |
| InChIKey | ZKCBPXPYVDCSCD-NDENLUEZSA-N |
| XLogP | 3.49 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|