C22H17F3N4OS — CID 134374773
4-[1-(4-cyanophenyl)-4-hydroxy-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 134374773) has the molecular formula C22H17F3N4OS and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-[1-(4-cyanophenyl)-4-hydroxy-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[1-(4-cyanophenyl)-4-hydroxy-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 134374773 |
| Molecular Formula | C22H17F3N4OS |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-[1-(4-cyanophenyl)-4-hydroxy-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(O)C23CCCC3)cc1 |
| InChI | InChI=1S/C22H17F3N4OS/c23-22(24,25)18-11-17(8-5-15(18)13-27)28-19(30)21(9-1-2-10-21)29(20(28)31)16-6-3-14(12-26)4-7-16/h3-8,11,19,30H,1-2,9-10H2 |
| InChIKey | VRBARUZISZTBMZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|