C16H17F3N4OS — CID 141160955
4-(8-methyl-4-oxo-2-sulfanyl-1,3,8-triazaspiro[4.5]decan-3-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 141160955) has the molecular formula C16H17F3N4OS and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-(8-methyl-4-oxo-2-sulfanyl-1,3,8-triazaspiro[4.5]decan-3-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(8-methyl-4-oxo-2-sulfanyl-1,3,8-triazaspiro[4.5]decan-3-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 141160955 |
| Molecular Formula | C16H17F3N4OS |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-(8-methyl-4-oxo-2-sulfanyl-1,3,8-triazaspiro[4.5]decan-3-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CN1CCC2(CC1)NC(S)N(c1ccc(C#N)c(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C16H17F3N4OS/c1-22-6-4-15(5-7-22)13(24)23(14(25)21-15)11-3-2-10(9-20)12(8-11)16(17,18)19/h2-3,8,14,21,25H,4-7H2,1H3 |
| InChIKey | SMDMZHYNNDJBIM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|