C20H26N2O2 — CID 141032974
1-[4-[2-(2-methylpropylamino)ethoxy]phenyl]-6,7-dihydro-5H-indol-4-one (PubChem CID 141032974) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[4-[2-(2-methylpropylamino)ethoxy]phenyl]-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-[4-[2-(2-methylpropylamino)ethoxy]phenyl]-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 141032974 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[4-[2-(2-methylpropylamino)ethoxy]phenyl]-6,7-dihydro-5H-indol-4-one |
| SMILES | CC(C)CNCCOc1ccc(-n2ccc3c2CCCC3=O)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-15(2)14-21-11-13-24-17-8-6-16(7-9-17)22-12-10-18-19(22)4-3-5-20(18)23/h6-10,12,15,21H,3-5,11,13-14H2,1-2H3 |
| InChIKey | MFJHEWWRAFFAFO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|