C14H18N2Se — CID 102416697
N-cyclohexyl-6-methyl-1,3-benzoselenazol-2-amine (PubChem CID 102416697) has the molecular formula C14H18N2Se and a molecular weight of 293.27 g/mol. Its IUPAC name is N-cyclohexyl-6-methyl-1,3-benzoselenazol-2-amine.
| Compound Name | N-cyclohexyl-6-methyl-1,3-benzoselenazol-2-amine |
|---|---|
| PubChem CID | 102416697 |
| Molecular Formula | C14H18N2Se |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-cyclohexyl-6-methyl-1,3-benzoselenazol-2-amine |
| SMILES | Cc1ccc2nc(NC3CCCCC3)[se]c2c1 |
| InChI | InChI=1S/C14H18N2Se/c1-10-7-8-12-13(9-10)17-14(16-12)15-11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3,(H,15,16) |
| InChIKey | POXMFAAMCOQIHY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|