C14H15N3S — CID 107804874
2-(1,3-benzothiazol-6-ylamino)cyclohexane-1-carbonitrile (PubChem CID 107804874) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-ylamino)cyclohexane-1-carbonitrile.
| Compound Name | 2-(1,3-benzothiazol-6-ylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 107804874 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-(1,3-benzothiazol-6-ylamino)cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCCCC1Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H15N3S/c15-8-10-3-1-2-4-12(10)17-11-5-6-13-14(7-11)18-9-16-13/h5-7,9-10,12,17H,1-4H2 |
| InChIKey | BDAYCODEBNVUOV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |