C12H14N2S — CID 1477439
2-piperidin-4-yl-1,3-benzothiazole (PubChem CID 1477439) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,3-benzothiazole.
| Compound Name | 2-piperidin-4-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 1477439 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-piperidin-4-yl-1,3-benzothiazole |
| SMILES | c1ccc2sc(C3CCNCC3)nc2c1 |
| InChI | InChI=1S/C12H14N2S/c1-2-4-11-10(3-1)14-12(15-11)9-5-7-13-8-6-9/h1-4,9,13H,5-8H2 |
| InChIKey | CYASANLJWAJEPW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |