C17H24FNO2 — CID 134060945
N-cyclopentyl-N-ethyl-3-(3-fluoro-4-methoxyphenyl)propanamide (PubChem CID 134060945) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is N-cyclopentyl-N-ethyl-3-(3-fluoro-4-methoxyphenyl)propanamide.
| Compound Name | N-cyclopentyl-N-ethyl-3-(3-fluoro-4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 134060945 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-cyclopentyl-N-ethyl-3-(3-fluoro-4-methoxyphenyl)propanamide |
| SMILES | CCN(C(=O)CCc1ccc(OC)c(F)c1)C1CCCC1 |
| InChI | InChI=1S/C17H24FNO2/c1-3-19(14-6-4-5-7-14)17(20)11-9-13-8-10-16(21-2)15(18)12-13/h8,10,12,14H,3-7,9,11H2,1-2H3 |
| InChIKey | BOEXKKVKUZJLOE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |