C12H9BrF2N2O2 — CID 178143844
2-(4-bromo-2,5-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)acetamide (PubChem CID 178143844) has the molecular formula C12H9BrF2N2O2 and a molecular weight of 331.12 g/mol. Its IUPAC name is 2-(4-bromo-2,5-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)acetamide.
| Compound Name | 2-(4-bromo-2,5-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 178143844 |
| Molecular Formula | C12H9BrF2N2O2 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-(4-bromo-2,5-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1cc(F)c(Br)cc1F)NCc1ncco1 |
| InChI | InChI=1S/C12H9BrF2N2O2/c13-8-5-9(14)7(3-10(8)15)4-11(18)17-6-12-16-1-2-19-12/h1-3,5H,4,6H2,(H,17,18) |
| InChIKey | GZMMSDQAWGLXSN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|