C14H16BrF2NO2 — CID 122034213
4-[(2-bromo-4,5-difluorophenyl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 122034213) has the molecular formula C14H16BrF2NO2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 4-[(2-bromo-4,5-difluorophenyl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-bromo-4,5-difluorophenyl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122034213 |
| Molecular Formula | C14H16BrF2NO2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-[(2-bromo-4,5-difluorophenyl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2cc(F)c(F)cc2Br)CC1 |
| InChI | InChI=1S/C14H16BrF2NO2/c15-11-6-13(17)12(16)5-9(11)7-18-10-3-1-8(2-4-10)14(19)20/h5-6,8,10,18H,1-4,7H2,(H,19,20) |
| InChIKey | MPOHJMNSRMQLSS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|