C11H12FNO2 — CID 90220502
trans-ethyl (1R,2R)-2-(2-fluoro-4-pyridinyl)cyclopropane-1-carboxylate (PubChem CID 90220502) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-(2-fluoro-4-pyridinyl)cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-2-(2-fluoro-4-pyridinyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 90220502 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | trans-ethyl (1R,2R)-2-(2-fluoro-4-pyridinyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1c1ccnc(F)c1 |
| InChI | InChI=1S/C11H12FNO2/c1-2-15-11(14)9-6-8(9)7-3-4-13-10(12)5-7/h3-5,8-9H,2,6H2,1H3/t8-,9+/m0/s1 |
| InChIKey | ARKOHGVWZXLFOB-DTWKUNHWSA-N |
| XLogP | 1.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|