C18H26F3NO5SSi — CID 134957184
ethyl 1-[3-(trifluoromethylsulfonyloxy)-2-trimethylsilylphenyl]piperidine-4-carboxylate (PubChem CID 134957184) has the molecular formula C18H26F3NO5SSi and a molecular weight of 453.56 g/mol. Its IUPAC name is ethyl 1-[3-(trifluoromethylsulfonyloxy)-2-trimethylsilylphenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(trifluoromethylsulfonyloxy)-2-trimethylsilylphenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 134957184 |
| Molecular Formula | C18H26F3NO5SSi |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | ethyl 1-[3-(trifluoromethylsulfonyloxy)-2-trimethylsilylphenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cccc(OS(=O)(=O)C(F)(F)F)c2[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C18H26F3NO5SSi/c1-5-26-17(23)13-9-11-22(12-10-13)14-7-6-8-15(16(14)29(2,3)4)27-28(24,25)18(19,20)21/h6-8,13H,5,9-12H2,1-4H3 |
| InChIKey | UNXMKQGAFCPDNF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|