C21H22F3NO3 — CID 172543076
ethyl 1-[2-[4-(trifluoromethyl)phenoxy]phenyl]piperidine-4-carboxylate (PubChem CID 172543076) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is ethyl 1-[2-[4-(trifluoromethyl)phenoxy]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[4-(trifluoromethyl)phenoxy]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 172543076 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl 1-[2-[4-(trifluoromethyl)phenoxy]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccccc2Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H22F3NO3/c1-2-27-20(26)15-11-13-25(14-12-15)18-5-3-4-6-19(18)28-17-9-7-16(8-10-17)21(22,23)24/h3-10,15H,2,11-14H2,1H3 |
| InChIKey | YRAJZYCZDBETBZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |