C22H32F3NO2 — CID 167106709
ethyl 1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine-4-carboxylate (PubChem CID 167106709) has the molecular formula C22H32F3NO2 and a molecular weight of 399.50 g/mol. Its IUPAC name is ethyl 1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 167106709 |
| Molecular Formula | C22H32F3NO2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | ethyl 1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(C)CC(C)(CC)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H32F3NO2/c1-5-21(4,18-7-9-19(10-8-18)22(23,24)25)15-16(3)26-13-11-17(12-14-26)20(27)28-6-2/h7-10,16-17H,5-6,11-15H2,1-4H3 |
| InChIKey | XPKZTUSEJHSOTQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |