C20H30F3NO — CID 165134929
4-methoxy-1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine (PubChem CID 165134929) has the molecular formula C20H30F3NO and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-methoxy-1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine.
| Compound Name | 4-methoxy-1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine |
|---|---|
| PubChem CID | 165134929 |
| Molecular Formula | C20H30F3NO |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 4-methoxy-1-[4-methyl-4-[4-(trifluoromethyl)phenyl]hexan-2-yl]piperidine |
| SMILES | CCC(C)(CC(C)N1CCC(OC)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H30F3NO/c1-5-19(3,16-6-8-17(9-7-16)20(21,22)23)14-15(2)24-12-10-18(25-4)11-13-24/h6-9,15,18H,5,10-14H2,1-4H3 |
| InChIKey | NXDOGZAAJZXABC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |