C22H26F3NO2 — CID 68971762
(2R)-2-[4-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]propan-1-ol (PubChem CID 68971762) has the molecular formula C22H26F3NO2 and a molecular weight of 393.45 g/mol. Its IUPAC name is (2R)-2-[4-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]propan-1-ol.
| Compound Name | (2R)-2-[4-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 68971762 |
| Molecular Formula | C22H26F3NO2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2R)-2-[4-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]propan-1-ol |
| SMILES | C[C@H](CO)N1CCC(C(Oc2ccccc2)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H26F3NO2/c1-16(15-27)26-13-11-18(12-14-26)21(28-20-5-3-2-4-6-20)17-7-9-19(10-8-17)22(23,24)25/h2-10,16,18,21,27H,11-15H2,1H3/t16-,21?/m1/s1 |
| InChIKey | PBUQWDPWLITHRV-UJONTBEJSA-N |
| XLogP | 4.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |