C21H24F3NO2 — CID 23458321
2-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]-4-propan-2-ylmorpholine (PubChem CID 23458321) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]-4-propan-2-ylmorpholine.
| Compound Name | 2-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 23458321 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[phenoxy-[4-(trifluoromethyl)phenyl]methyl]-4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCOC(C(Oc2ccccc2)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C21H24F3NO2/c1-15(2)25-12-13-26-19(14-25)20(27-18-6-4-3-5-7-18)16-8-10-17(11-9-16)21(22,23)24/h3-11,15,19-20H,12-14H2,1-2H3 |
| InChIKey | PVBYPCNFOLUSJN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |